N~2~-(2-methoxyphenyl)-N~2~-(4-methylbenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-(2-methoxyphenyl)-N~2~-(4-methylbenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]glycinamide
N~2~-(2-methoxyphenyl)-N~2~-(4-methylbenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]glycinamide
Compound characteristics
| Compound ID: | 4577-0952 |
| Compound Name: | N~2~-(2-methoxyphenyl)-N~2~-(4-methylbenzene-1-sulfonyl)-N-[(4-methylphenyl)methyl]glycinamide |
| Molecular Weight: | 438.54 |
| Molecular Formula: | C24 H26 N2 O4 S |
| Smiles: | Cc1ccc(CNC(CN(c2ccccc2OC)S(c2ccc(C)cc2)(=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2798 |
| logD: | 4.2798 |
| logSw: | -4.3214 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.593 |
| InChI Key: | BBRHZWRIXOCDDG-UHFFFAOYSA-N |