N~2~-(4-chlorophenyl)-N~2~-(4-methoxybenzene-1-sulfonyl)-N-[(4-methoxyphenyl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-(4-chlorophenyl)-N~2~-(4-methoxybenzene-1-sulfonyl)-N-[(4-methoxyphenyl)methyl]glycinamide
N~2~-(4-chlorophenyl)-N~2~-(4-methoxybenzene-1-sulfonyl)-N-[(4-methoxyphenyl)methyl]glycinamide
Compound characteristics
| Compound ID: | 4577-2491 |
| Compound Name: | N~2~-(4-chlorophenyl)-N~2~-(4-methoxybenzene-1-sulfonyl)-N-[(4-methoxyphenyl)methyl]glycinamide |
| Molecular Weight: | 474.96 |
| Molecular Formula: | C23 H23 Cl N2 O5 S |
| Smiles: | COc1ccc(CNC(CN(c2ccc(cc2)[Cl])S(c2ccc(cc2)OC)(=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2157 |
| logD: | 4.2157 |
| logSw: | -4.5345 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.351 |
| InChI Key: | YXNQVBNHFQYETM-UHFFFAOYSA-N |