N-[2-(benzylsulfanyl)ethyl]-N~2~-(2,3-dimethylphenyl)-N~2~-(methanesulfonyl)glycinamide
Chemical Structure Depiction of
N-[2-(benzylsulfanyl)ethyl]-N~2~-(2,3-dimethylphenyl)-N~2~-(methanesulfonyl)glycinamide
N-[2-(benzylsulfanyl)ethyl]-N~2~-(2,3-dimethylphenyl)-N~2~-(methanesulfonyl)glycinamide
Compound characteristics
| Compound ID: | 4577-2502 |
| Compound Name: | N-[2-(benzylsulfanyl)ethyl]-N~2~-(2,3-dimethylphenyl)-N~2~-(methanesulfonyl)glycinamide |
| Molecular Weight: | 406.56 |
| Molecular Formula: | C20 H26 N2 O3 S2 |
| Smiles: | Cc1cccc(c1C)N(CC(NCCSCc1ccccc1)=O)S(C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1883 |
| logD: | 3.1883 |
| logSw: | -3.4274 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.568 |
| InChI Key: | NOKREMPLNFGAKV-UHFFFAOYSA-N |