3-(2H-1-benzopyran-3-yl)-2-cyano-N-cyclohexylprop-2-enamide
Chemical Structure Depiction of
3-(2H-1-benzopyran-3-yl)-2-cyano-N-cyclohexylprop-2-enamide
3-(2H-1-benzopyran-3-yl)-2-cyano-N-cyclohexylprop-2-enamide
Compound characteristics
| Compound ID: | 4578-0613 |
| Compound Name: | 3-(2H-1-benzopyran-3-yl)-2-cyano-N-cyclohexylprop-2-enamide |
| Molecular Weight: | 308.38 |
| Molecular Formula: | C19 H20 N2 O2 |
| Smiles: | C1CCC(CC1)NC(C(=C\C1COc2ccccc2C=1)\C#N)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1786 |
| logD: | 4.1785 |
| logSw: | -4.3702 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.803 |
| InChI Key: | FYSCKBVOFAXMTC-UHFFFAOYSA-N |