ethyl 4-(3,4-dimethoxybenzoyl)piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-(3,4-dimethoxybenzoyl)piperazine-1-carboxylate
ethyl 4-(3,4-dimethoxybenzoyl)piperazine-1-carboxylate
Compound characteristics
| Compound ID: | 4581-0996 |
| Compound Name: | ethyl 4-(3,4-dimethoxybenzoyl)piperazine-1-carboxylate |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C16 H22 N2 O5 |
| Smiles: | CCOC(N1CCN(CC1)C(c1ccc(c(c1)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1798 |
| logD: | 1.1798 |
| logSw: | -2.058 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.928 |
| InChI Key: | IBKMWPLCFWCYMC-UHFFFAOYSA-N |