5-methyl-N-{4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl}-3-phenyl-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
5-methyl-N-{4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl}-3-phenyl-1,2-oxazole-4-carboxamide
5-methyl-N-{4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl}-3-phenyl-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | 4606-3689 |
| Compound Name: | 5-methyl-N-{4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl}-3-phenyl-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 449.49 |
| Molecular Formula: | C22 H19 N5 O4 S |
| Smiles: | Cc1ccnc(NS(c2ccc(cc2)NC(c2c(c3ccccc3)noc2C)=O)(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.6008 |
| logD: | 1.989 |
| logSw: | -3.3319 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 105.883 |
| InChI Key: | VBGWRHUAOIVHQO-UHFFFAOYSA-N |