N,N-dimethyl-1-phenyl-N-(prop-2-en-1-yl)hex-5-en-1-yn-3-aminium--bromide (1/1)
Chemical Structure Depiction of
N,N-dimethyl-1-phenyl-N-(prop-2-en-1-yl)hex-5-en-1-yn-3-aminium--bromide (1/1)
N,N-dimethyl-1-phenyl-N-(prop-2-en-1-yl)hex-5-en-1-yn-3-aminium--bromide (1/1)
Compound characteristics
| Compound ID: | 4636-0028 |
| Compound Name: | N,N-dimethyl-1-phenyl-N-(prop-2-en-1-yl)hex-5-en-1-yn-3-aminium--bromide (1/1) |
| Molecular Weight: | 320.27 |
| Molecular Formula: | C17 H22 N |
| Salt: | Br- |
| Smiles: | C[N+](C)(CC=C)C(CC=C)C#Cc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.149 |
| logD: | 4.149 |
| logSw: | -4.1798 |
| Polar surface area: | -0.6947 |
| InChI Key: | DYTTXXJDSOOLPC-KRWDZBQOSA-N |