3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-1-[(4-chlorophenyl)methyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-1-[(4-chlorophenyl)methyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one
3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-1-[(4-chlorophenyl)methyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | 4655-0022 |
| Compound Name: | 3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-1-[(4-chlorophenyl)methyl]-3-hydroxy-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 476.77 |
| Molecular Formula: | C21 H15 Br Cl N O3 S |
| Smiles: | C(C(c1ccc(s1)[Br])=O)C1(C(N(Cc2ccc(cc2)[Cl])c2ccccc12)=O)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0257 |
| logD: | 5.0257 |
| logSw: | -4.8668 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.061 |
| InChI Key: | JEGGYFGIRSOSAC-NRFANRHFSA-N |