5-[(4-methylphenyl)methylidene]-2-(pyrrolidin-1-yl)-1,3-thiazol-4(5H)-one
Chemical Structure Depiction of
5-[(4-methylphenyl)methylidene]-2-(pyrrolidin-1-yl)-1,3-thiazol-4(5H)-one
5-[(4-methylphenyl)methylidene]-2-(pyrrolidin-1-yl)-1,3-thiazol-4(5H)-one
Compound characteristics
| Compound ID: | 4670-0042 |
| Compound Name: | 5-[(4-methylphenyl)methylidene]-2-(pyrrolidin-1-yl)-1,3-thiazol-4(5H)-one |
| Molecular Weight: | 272.37 |
| Molecular Formula: | C15 H16 N2 O S |
| Smiles: | Cc1ccc(\C=C2/C(N=C(N3CCCC3)S2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3286 |
| logD: | 3.3286 |
| logSw: | -3.4051 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 25.9611 |
| InChI Key: | BBOPZMIUSLVPJX-UHFFFAOYSA-N |