ethyl 2-{[(1,3-dioxo-2,3-dihydro-1H-inden-2-yl)methylidene]amino}-5-methylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-{[(1,3-dioxo-2,3-dihydro-1H-inden-2-yl)methylidene]amino}-5-methylthiophene-3-carboxylate
ethyl 2-{[(1,3-dioxo-2,3-dihydro-1H-inden-2-yl)methylidene]amino}-5-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | 4673-0441 |
| Compound Name: | ethyl 2-{[(1,3-dioxo-2,3-dihydro-1H-inden-2-yl)methylidene]amino}-5-methylthiophene-3-carboxylate |
| Molecular Weight: | 341.38 |
| Molecular Formula: | C18 H15 N O4 S |
| Smiles: | CCOC(c1cc(C)sc1/N=C/C1C(c2ccccc2C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.345 |
| logD: | 2.2693 |
| logSw: | -3.6123 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.493 |
| InChI Key: | PJUXGALMCFEXNI-DJKKODMXSA-N |