rel-(4R,7S)-4-methyl-2-[4-(morpholin-4-yl)phenyl]-3a,4,7,7a-tetrahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione
Chemical Structure Depiction of
rel-(4R,7S)-4-methyl-2-[4-(morpholin-4-yl)phenyl]-3a,4,7,7a-tetrahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione
rel-(4R,7S)-4-methyl-2-[4-(morpholin-4-yl)phenyl]-3a,4,7,7a-tetrahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | 4676-0464 |
| Compound Name: | rel-(4R,7S)-4-methyl-2-[4-(morpholin-4-yl)phenyl]-3a,4,7,7a-tetrahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione |
| Molecular Weight: | 340.38 |
| Molecular Formula: | C19 H20 N2 O4 |
| Smiles: | C[C@]12C=C[C@H](C3C1C(N(C3=O)c1ccc(cc1)N1CCOCC1)=O)O2 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 0.9995 |
| logD: | 0.9994 |
| logSw: | -1.8102 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.162 |
| InChI Key: | LTJAGZKGLNGMHB-UHFFFAOYSA-N |