4-(5-bromo-2,4-dimethoxyphenyl)-N,6-dimethyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
4-(5-bromo-2,4-dimethoxyphenyl)-N,6-dimethyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
4-(5-bromo-2,4-dimethoxyphenyl)-N,6-dimethyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 4681-3795 |
| Compound Name: | 4-(5-bromo-2,4-dimethoxyphenyl)-N,6-dimethyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 400.29 |
| Molecular Formula: | C15 H18 Br N3 O3 S |
| Smiles: | CC1=C(C(c2cc(c(cc2OC)OC)[Br])NC(N1)=S)C(NC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9076 |
| logD: | 1.9067 |
| logSw: | -2.6559 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 62.77 |
| InChI Key: | AXCQNUCSELVKGL-ZDUSSCGKSA-N |