2-benzyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
Chemical Structure Depiction of
2-benzyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
2-benzyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
Compound characteristics
| Compound ID: | 4708-0114 |
| Compound Name: | 2-benzyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| Molecular Weight: | 476.58 |
| Molecular Formula: | C30 H28 N4 O2 |
| Smiles: | Cc1c(Cc2ccccc2)c(NCCc2ccc(c(c2)OC)OC)n2c3ccccc3nc2c1C#N |
| Stereo: | ACHIRAL |
| logP: | 6.0116 |
| logD: | 6.0113 |
| logSw: | -5.6772 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.845 |
| InChI Key: | OGGYEKJPYAPKDO-UHFFFAOYSA-N |