(3-amino-5,6,7,8,9,10-hexahydrocycloocta[b]thieno[3,2-e]pyridin-2-yl)(4-chlorophenyl)methanone
Chemical Structure Depiction of
(3-amino-5,6,7,8,9,10-hexahydrocycloocta[b]thieno[3,2-e]pyridin-2-yl)(4-chlorophenyl)methanone
(3-amino-5,6,7,8,9,10-hexahydrocycloocta[b]thieno[3,2-e]pyridin-2-yl)(4-chlorophenyl)methanone
Compound characteristics
| Compound ID: | 4729-0179 |
| Compound Name: | (3-amino-5,6,7,8,9,10-hexahydrocycloocta[b]thieno[3,2-e]pyridin-2-yl)(4-chlorophenyl)methanone |
| Molecular Weight: | 370.9 |
| Molecular Formula: | C20 H19 Cl N2 O S |
| Smiles: | C1CCCc2c(CC1)cc1c(c(C(c3ccc(cc3)[Cl])=O)sc1n2)N |
| Stereo: | ACHIRAL |
| logP: | 6.0845 |
| logD: | 6.0837 |
| logSw: | -6.3159 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.564 |
| InChI Key: | PKJRYJNTYNMYJC-UHFFFAOYSA-N |