7-benzyl-2-chloro-6-(piperidin-1-yl)-7H-purine
Chemical Structure Depiction of
7-benzyl-2-chloro-6-(piperidin-1-yl)-7H-purine
7-benzyl-2-chloro-6-(piperidin-1-yl)-7H-purine
Compound characteristics
| Compound ID: | 4753-0111 |
| Compound Name: | 7-benzyl-2-chloro-6-(piperidin-1-yl)-7H-purine |
| Molecular Weight: | 327.81 |
| Molecular Formula: | C17 H18 Cl N5 |
| Smiles: | C1CCN(CC1)c1c2c(ncn2Cc2ccccc2)nc(n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.7271 |
| logD: | 3.7271 |
| logSw: | -4.059 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 33.216 |
| InChI Key: | DZRXCRPVWYHKKE-UHFFFAOYSA-N |