5-({4-bromo-5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-2-sulfanylideneimidazolidin-4-one
Chemical Structure Depiction of
5-({4-bromo-5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-2-sulfanylideneimidazolidin-4-one
5-({4-bromo-5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-2-sulfanylideneimidazolidin-4-one
Compound characteristics
| Compound ID: | 4765-1913 |
| Compound Name: | 5-({4-bromo-5-[(4-chlorophenyl)sulfanyl]furan-2-yl}methylidene)-2-sulfanylideneimidazolidin-4-one |
| Molecular Weight: | 415.71 |
| Molecular Formula: | C14 H8 Br Cl N2 O2 S2 |
| Smiles: | C(=C1/C(NC(N1)=S)=O)/c1cc(c(o1)Sc1ccc(cc1)[Cl])[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.6055 |
| logD: | 4.5826 |
| logSw: | -4.7851 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.317 |
| InChI Key: | KKKCNJKFSBERMN-UHFFFAOYSA-N |