ethyl 6,8-dichloro-4-(2-methoxyanilino)quinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 6,8-dichloro-4-(2-methoxyanilino)quinoline-3-carboxylate
ethyl 6,8-dichloro-4-(2-methoxyanilino)quinoline-3-carboxylate
Compound characteristics
| Compound ID: | 4789-4440 |
| Compound Name: | ethyl 6,8-dichloro-4-(2-methoxyanilino)quinoline-3-carboxylate |
| Molecular Weight: | 391.25 |
| Molecular Formula: | C19 H16 Cl2 N2 O3 |
| Smiles: | CCOC(c1cnc2c(cc(cc2c1Nc1ccccc1OC)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.523 |
| logD: | 5.523 |
| logSw: | -5.9547 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.064 |
| InChI Key: | VZTAKXVFSVPXAV-UHFFFAOYSA-N |