6-bromo-3-{[butyl(methyl)amino]methyl}-2-methylquinolin-4-ol
Chemical Structure Depiction of
6-bromo-3-{[butyl(methyl)amino]methyl}-2-methylquinolin-4-ol
6-bromo-3-{[butyl(methyl)amino]methyl}-2-methylquinolin-4-ol
Compound characteristics
| Compound ID: | 4789-4654 |
| Compound Name: | 6-bromo-3-{[butyl(methyl)amino]methyl}-2-methylquinolin-4-ol |
| Molecular Weight: | 337.26 |
| Molecular Formula: | C16 H21 Br N2 O |
| Smiles: | CCCCN(C)Cc1c(c2cc(ccc2nc1C)[Br])O |
| Stereo: | ACHIRAL |
| logP: | 4.3309 |
| logD: | 3.9904 |
| logSw: | -4.0499 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.7193 |
| InChI Key: | ZVBYDEONOULDFL-UHFFFAOYSA-N |