4-{4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl}-6-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
Chemical Structure Depiction of
4-{4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl}-6-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
4-{4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl}-6-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | 4852-0695 |
| Compound Name: | 4-{4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl}-6-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine |
| Molecular Weight: | 443.01 |
| Molecular Formula: | C23 H27 Cl N4 O S |
| Smiles: | CC1CCc2c(C1)c1c(ncnc1s2)N1CCN(CC1)CCOc1ccc(cc1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.044 |
| logD: | 6.0076 |
| logSw: | -6.3082 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.396 |
| InChI Key: | DVULIVOJNMMJIE-MRXNPFEDSA-N |