2-butyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
Chemical Structure Depiction of
2-butyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
2-butyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile
Compound characteristics
| Compound ID: | 4852-0831 |
| Compound Name: | 2-butyl-1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| Molecular Weight: | 442.56 |
| Molecular Formula: | C27 H30 N4 O2 |
| Smiles: | CCCCc1c(C)c(C#N)c2nc3ccccc3n2c1NCCc1ccc(c(c1)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 6.0134 |
| logD: | 6.0128 |
| logSw: | -5.5263 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.117 |
| InChI Key: | SXEVFMVPVOXNKA-UHFFFAOYSA-N |