11-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
Chemical Structure Depiction of
11-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
11-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
Compound characteristics
| Compound ID: | 4886-7689 |
| Compound Name: | 11-(3-bromo-5-ethoxy-4-hydroxyphenyl)-3,3-dimethyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one |
| Molecular Weight: | 457.37 |
| Molecular Formula: | C23 H25 Br N2 O3 |
| Smiles: | CCOc1cc(cc(c1O)[Br])C1C2=C(CC(C)(C)CC2=O)Nc2ccccc2N1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8257 |
| logD: | 4.8037 |
| logSw: | -4.3849 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 59.438 |
| InChI Key: | ZHWGMJDUQZGFAC-NRFANRHFSA-N |