2-methoxy-4-[3-(propylsulfanyl)-6,7-dihydro[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol
					Chemical Structure Depiction of
2-methoxy-4-[3-(propylsulfanyl)-6,7-dihydro[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol
			2-methoxy-4-[3-(propylsulfanyl)-6,7-dihydro[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol
Compound characteristics
| Compound ID: | 4896-1429 | 
| Compound Name: | 2-methoxy-4-[3-(propylsulfanyl)-6,7-dihydro[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol | 
| Molecular Weight: | 396.47 | 
| Molecular Formula: | C20 H20 N4 O3 S | 
| Smiles: | CCCSc1nc2c(c3ccccc3NC(c3ccc(c(c3)OC)O)O2)nn1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 3.5778 | 
| logD: | 3.5731 | 
| logSw: | -3.5183 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 76.476 | 
| InChI Key: | QBVGVBJQFUXUTF-SFHVURJKSA-N | 
 
				 
				