2-(4-methylphenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazol-4(5H)-one
Chemical Structure Depiction of
2-(4-methylphenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazol-4(5H)-one
2-(4-methylphenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazol-4(5H)-one
Compound characteristics
| Compound ID: | 4896-2504 |
| Compound Name: | 2-(4-methylphenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazol-4(5H)-one |
| Molecular Weight: | 299.41 |
| Molecular Formula: | C16 H13 N O S2 |
| Smiles: | Cc1ccc(cc1)C1=NC(/C(=C/c2c(C)ccs2)S1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2483 |
| logD: | 4.2483 |
| logSw: | -4.255 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 23.3062 |
| InChI Key: | WCPJLSBBULSLPN-UHFFFAOYSA-N |