2-(2-{2-[(2-chlorophenyl)methoxy]phenyl}ethenyl)quinolin-8-ol
Chemical Structure Depiction of
2-(2-{2-[(2-chlorophenyl)methoxy]phenyl}ethenyl)quinolin-8-ol
2-(2-{2-[(2-chlorophenyl)methoxy]phenyl}ethenyl)quinolin-8-ol
Compound characteristics
| Compound ID: | 4896-3972 |
| Compound Name: | 2-(2-{2-[(2-chlorophenyl)methoxy]phenyl}ethenyl)quinolin-8-ol |
| Molecular Weight: | 387.86 |
| Molecular Formula: | C24 H18 Cl N O2 |
| Smiles: | C(c1ccccc1[Cl])Oc1ccccc1/C=C/c1ccc2cccc(c2n1)O |
| Stereo: | ACHIRAL |
| logP: | 6.5671 |
| logD: | 6.5628 |
| logSw: | -6.2715 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.426 |
| InChI Key: | KNCKGFQSMLPZLS-UHFFFAOYSA-N |