8-[(2-chlorophenyl)methoxy]-2-[2-(2,3,4-trimethoxyphenyl)ethenyl]quinoline
					Chemical Structure Depiction of
8-[(2-chlorophenyl)methoxy]-2-[2-(2,3,4-trimethoxyphenyl)ethenyl]quinoline
			8-[(2-chlorophenyl)methoxy]-2-[2-(2,3,4-trimethoxyphenyl)ethenyl]quinoline
Compound characteristics
| Compound ID: | 4896-4885 | 
| Compound Name: | 8-[(2-chlorophenyl)methoxy]-2-[2-(2,3,4-trimethoxyphenyl)ethenyl]quinoline | 
| Molecular Weight: | 461.94 | 
| Molecular Formula: | C27 H24 Cl N O4 | 
| Smiles: | COc1ccc(/C=C/c2ccc3cccc(c3n2)OCc2ccccc2[Cl])c(c1OC)OC | 
| Stereo: | ACHIRAL | 
| logP: | 6.4611 | 
| logD: | 6.4609 | 
| logSw: | -6.5996 | 
| Hydrogen bond acceptors count: | 5 | 
| Polar surface area: | 39.942 | 
| InChI Key: | IUFZVWUKRIZZNA-UHFFFAOYSA-N | 
 
				 
				