5-bromo-3-[(5-chloro-2-methoxyphenyl)methylidene]-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
5-bromo-3-[(5-chloro-2-methoxyphenyl)methylidene]-1,3-dihydro-2H-indol-2-one
5-bromo-3-[(5-chloro-2-methoxyphenyl)methylidene]-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | 4896-5015 |
| Compound Name: | 5-bromo-3-[(5-chloro-2-methoxyphenyl)methylidene]-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 364.62 |
| Molecular Formula: | C16 H11 Br Cl N O2 |
| Smiles: | COc1ccc(cc1/C=C1C(Nc2ccc(cc/12)[Br])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.8308 |
| logD: | 4.8308 |
| logSw: | -4.8041 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.841 |
| InChI Key: | XPAWKIXEULNEGZ-UHFFFAOYSA-N |