2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol
					Chemical Structure Depiction of
2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol
			2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol
Compound characteristics
| Compound ID: | 4896-5372 | 
| Compound Name: | 2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol | 
| Molecular Weight: | 383.45 | 
| Molecular Formula: | C25 H21 N O3 | 
| Smiles: | COc1cc(/C=C/c2ccc3cccc(c3n2)O)ccc1OCc1ccccc1 | 
| Stereo: | ACHIRAL | 
| logP: | 5.6176 | 
| logD: | 5.6132 | 
| logSw: | -6.2134 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 41.056 | 
| InChI Key: | FMSPSCVUPXPCTL-UHFFFAOYSA-N | 
 
				 
				