2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol
Chemical Structure Depiction of
2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol
2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol
Compound characteristics
| Compound ID: | 4896-5372 |
| Compound Name: | 2-{2-[4-(benzyloxy)-3-methoxyphenyl]ethenyl}quinolin-8-ol |
| Molecular Weight: | 383.45 |
| Molecular Formula: | C25 H21 N O3 |
| Smiles: | COc1cc(/C=C/c2ccc3cccc(c3n2)O)ccc1OCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.6176 |
| logD: | 5.6132 |
| logSw: | -6.2134 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.056 |
| InChI Key: | FMSPSCVUPXPCTL-UHFFFAOYSA-N |