5-chloro-N-(4-ethoxyphenyl)-3-methyl-1-phenyl-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
5-chloro-N-(4-ethoxyphenyl)-3-methyl-1-phenyl-1H-pyrazole-4-carboxamide
5-chloro-N-(4-ethoxyphenyl)-3-methyl-1-phenyl-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | 4901-0165 |
| Compound Name: | 5-chloro-N-(4-ethoxyphenyl)-3-methyl-1-phenyl-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 355.82 |
| Molecular Formula: | C19 H18 Cl N3 O2 |
| Smiles: | CCOc1ccc(cc1)NC(c1c(C)nn(c2ccccc2)c1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8316 |
| logD: | 3.8308 |
| logSw: | -4.7226 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.253 |
| InChI Key: | OQVOYRXUKRVSBN-UHFFFAOYSA-N |