N-(2H-1,3-benzodioxol-5-yl)-2-methyl-5-(4-oxo-3,4-dihydrophthalazin-1-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2H-1,3-benzodioxol-5-yl)-2-methyl-5-(4-oxo-3,4-dihydrophthalazin-1-yl)benzene-1-sulfonamide
N-(2H-1,3-benzodioxol-5-yl)-2-methyl-5-(4-oxo-3,4-dihydrophthalazin-1-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 4903-2192 |
| Compound Name: | N-(2H-1,3-benzodioxol-5-yl)-2-methyl-5-(4-oxo-3,4-dihydrophthalazin-1-yl)benzene-1-sulfonamide |
| Molecular Weight: | 435.46 |
| Molecular Formula: | C22 H17 N3 O5 S |
| Smiles: | Cc1ccc(cc1S(Nc1ccc2c(c1)OCO2)(=O)=O)C1c2ccccc2C(NN=1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7075 |
| logD: | 3.0133 |
| logSw: | -3.8876 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 94.123 |
| InChI Key: | IRYYGJMLKLDBOS-UHFFFAOYSA-N |