N-(5-chloro-2,4-dimethoxyphenyl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2,4-dimethoxyphenyl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
N-(5-chloro-2,4-dimethoxyphenyl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | 4904-5442 |
| Compound Name: | N-(5-chloro-2,4-dimethoxyphenyl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 407.25 |
| Molecular Formula: | C19 H16 Cl2 N2 O4 |
| Smiles: | Cc1c(C(Nc2cc(c(cc2OC)OC)[Cl])=O)c(c2ccccc2[Cl])no1 |
| Stereo: | ACHIRAL |
| logP: | 4.3494 |
| logD: | 4.0551 |
| logSw: | -4.735 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.853 |
| InChI Key: | BWZYZHNMIOYBFA-UHFFFAOYSA-N |