5-(4-fluorophenyl)-1-(methanesulfonyl)-3-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazole
Chemical Structure Depiction of
5-(4-fluorophenyl)-1-(methanesulfonyl)-3-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazole
5-(4-fluorophenyl)-1-(methanesulfonyl)-3-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazole
Compound characteristics
| Compound ID: | 4909-0125 |
| Compound Name: | 5-(4-fluorophenyl)-1-(methanesulfonyl)-3-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazole |
| Molecular Weight: | 348.39 |
| Molecular Formula: | C17 H17 F N2 O3 S |
| Smiles: | COc1ccc(cc1)C1CC(c2ccc(cc2)F)N(N=1)S(C)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3125 |
| logD: | 3.3125 |
| logSw: | -3.5223 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.659 |
| InChI Key: | XVPHWANLKLALDB-KRWDZBQOSA-N |