N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N'-(2-hydroxyethyl)urea
Chemical Structure Depiction of
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N'-(2-hydroxyethyl)urea
N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N'-(2-hydroxyethyl)urea
Compound characteristics
| Compound ID: | 4912-0334 |
| Compound Name: | N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-N'-(2-hydroxyethyl)urea |
| Molecular Weight: | 222.26 |
| Molecular Formula: | C7 H14 N2 O4 S |
| Smiles: | C1CS(CC1NC(NCCO)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -1.884 |
| logD: | -1.884 |
| logSw: | -1.2462 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 80.117 |
| InChI Key: | BCPLHWCCJGRAAF-ZCFIWIBFSA-N |