N,N'-bis(1,1-dioxo-1lambda~6~-thiolan-3-yl)thiourea
Chemical Structure Depiction of
N,N'-bis(1,1-dioxo-1lambda~6~-thiolan-3-yl)thiourea
N,N'-bis(1,1-dioxo-1lambda~6~-thiolan-3-yl)thiourea
Compound characteristics
| Compound ID: | 4912-0516 |
| Compound Name: | N,N'-bis(1,1-dioxo-1lambda~6~-thiolan-3-yl)thiourea |
| Molecular Weight: | 312.43 |
| Molecular Formula: | C9 H16 N2 O4 S3 |
| Smiles: | C1CS(CC1NC(NC1CCS(C1)(=O)=O)=S)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | -1.4321 |
| logD: | -1.4321 |
| logSw: | -1.3855 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.03 |
| InChI Key: | XEFICVPSYOOJMW-UHFFFAOYSA-N |