N-(2-chlorophenyl)-6-methyl-4-(2-methylphenyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(2-chlorophenyl)-6-methyl-4-(2-methylphenyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
N-(2-chlorophenyl)-6-methyl-4-(2-methylphenyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 4929-0209 |
| Compound Name: | N-(2-chlorophenyl)-6-methyl-4-(2-methylphenyl)-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 371.89 |
| Molecular Formula: | C19 H18 Cl N3 O S |
| Smiles: | CC1=C(C(c2ccccc2C)NC(N1)=S)C(Nc1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7552 |
| logD: | 3.7195 |
| logSw: | -3.911 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 45.068 |
| InChI Key: | OWOGNYOJXULRBJ-KRWDZBQOSA-N |