3-(4-methoxyphenyl)-3-phenyl-N-[(4-phenyloxan-4-yl)methyl]propanamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-3-phenyl-N-[(4-phenyloxan-4-yl)methyl]propanamide
3-(4-methoxyphenyl)-3-phenyl-N-[(4-phenyloxan-4-yl)methyl]propanamide
Compound characteristics
| Compound ID: | 4950-0031 |
| Compound Name: | 3-(4-methoxyphenyl)-3-phenyl-N-[(4-phenyloxan-4-yl)methyl]propanamide |
| Molecular Weight: | 429.56 |
| Molecular Formula: | C28 H31 N O3 |
| Smiles: | COc1ccc(cc1)C(CC(NCC1(CCOCC1)c1ccccc1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2487 |
| logD: | 5.2487 |
| logSw: | -5.1952 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.54 |
| InChI Key: | SBIPFOQZARKNJI-SANMLTNESA-N |