6-chloro-N,N-diethyl-2-(methylsulfanyl)-5-[(4-propoxyphenyl)methyl]pyrimidin-4-amine
Chemical Structure Depiction of
6-chloro-N,N-diethyl-2-(methylsulfanyl)-5-[(4-propoxyphenyl)methyl]pyrimidin-4-amine
6-chloro-N,N-diethyl-2-(methylsulfanyl)-5-[(4-propoxyphenyl)methyl]pyrimidin-4-amine
Compound characteristics
| Compound ID: | 4950-0261 |
| Compound Name: | 6-chloro-N,N-diethyl-2-(methylsulfanyl)-5-[(4-propoxyphenyl)methyl]pyrimidin-4-amine |
| Molecular Weight: | 379.95 |
| Molecular Formula: | C19 H26 Cl N3 O S |
| Smiles: | CCCOc1ccc(Cc2c(nc(nc2[Cl])SC)N(CC)CC)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.8935 |
| logD: | 5.8934 |
| logSw: | -6.0619 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 27.9844 |
| InChI Key: | KABLPSBRSXTVTI-UHFFFAOYSA-N |