1-{4-[(4-ethoxyphenyl)methyl]piperazin-1-yl}-2-(4-methylphenoxy)ethan-1-one--oxalic acid (1/1)
Chemical Structure Depiction of
1-{4-[(4-ethoxyphenyl)methyl]piperazin-1-yl}-2-(4-methylphenoxy)ethan-1-one--oxalic acid (1/1)
1-{4-[(4-ethoxyphenyl)methyl]piperazin-1-yl}-2-(4-methylphenoxy)ethan-1-one--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 4964-2298 |
| Compound Name: | 1-{4-[(4-ethoxyphenyl)methyl]piperazin-1-yl}-2-(4-methylphenoxy)ethan-1-one--oxalic acid (1/1) |
| Molecular Weight: | 458.51 |
| Molecular Formula: | C22 H28 N2 O3 |
| Salt: | HOOCCOOH |
| Smiles: | CCOc1ccc(CN2CCN(CC2)C(COc2ccc(C)cc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.9918 |
| logD: | 2.9766 |
| logSw: | -2.9532 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 34.522 |
| InChI Key: | FWKAYVHRJQVHLS-UHFFFAOYSA-N |