1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine--oxalic acid (1/1)
Chemical Structure Depiction of
1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine--oxalic acid (1/1)
1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 4964-2974 |
| Compound Name: | 1-[(5-bromo-2-methoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine--oxalic acid (1/1) |
| Molecular Weight: | 555.42 |
| Molecular Formula: | C22 H29 Br N2 O4 |
| Salt: | HOOCCOOH |
| Smiles: | COc1ccc(cc1CN1CCN(CC1)Cc1ccc(c(c1OC)OC)OC)[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.6692 |
| logD: | 2.6758 |
| logSw: | -3.7514 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.206 |
| InChI Key: | ZLQJHYAIASOLPN-UHFFFAOYSA-N |