2-({4-[(2-chlorophenyl)methyl]piperazin-1-yl}methyl)-4-methoxyphenol--oxalic acid (1/1)
					Chemical Structure Depiction of
2-({4-[(2-chlorophenyl)methyl]piperazin-1-yl}methyl)-4-methoxyphenol--oxalic acid (1/1)
			2-({4-[(2-chlorophenyl)methyl]piperazin-1-yl}methyl)-4-methoxyphenol--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 4964-3596 | 
| Compound Name: | 2-({4-[(2-chlorophenyl)methyl]piperazin-1-yl}methyl)-4-methoxyphenol--oxalic acid (1/1) | 
| Molecular Weight: | 436.89 | 
| Molecular Formula: | C19 H23 Cl N2 O2 | 
| Salt: | HOOCCOOH | 
| Smiles: | COc1ccc(c(CN2CCN(CC2)Cc2ccccc2[Cl])c1)O | 
| Stereo: | ACHIRAL | 
| logP: | 3.2562 | 
| logD: | 2.3079 | 
| logSw: | -3.0977 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 31.6033 | 
| InChI Key: | JJOTWMFMADDLMQ-UHFFFAOYSA-N | 
 
				 
				