2-[(4H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-[(4H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide
2-[(4H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | 4981-0384 |
| Compound Name: | 2-[(4H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 302.27 |
| Molecular Formula: | C11 H9 F3 N4 O S |
| Smiles: | C(C(Nc1ccccc1C(F)(F)F)=O)Sc1nnc[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 1.2548 |
| logD: | 0.9002 |
| logSw: | -2.3537 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.844 |
| InChI Key: | ABVMIOMXIGXOOQ-UHFFFAOYSA-N |