10-methyl-9-{4-[(prop-2-en-1-yl)oxy]phenyl}-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione
Chemical Structure Depiction of
10-methyl-9-{4-[(prop-2-en-1-yl)oxy]phenyl}-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione
10-methyl-9-{4-[(prop-2-en-1-yl)oxy]phenyl}-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione
Compound characteristics
| Compound ID: | 4984-0431 |
| Compound Name: | 10-methyl-9-{4-[(prop-2-en-1-yl)oxy]phenyl}-3,4,6,7,9,10-hexahydroacridine-1,8(2H,5H)-dione |
| Molecular Weight: | 363.46 |
| Molecular Formula: | C23 H25 N O3 |
| Smiles: | CN1C2CCCC(C=2C(C2=C1CCCC2=O)c1ccc(cc1)OCC=C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1272 |
| logD: | 3.1272 |
| logSw: | -3.3897 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.169 |
| InChI Key: | UVIHPSCCJNMSOB-UHFFFAOYSA-N |