methyl 5-methyl-4-{[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]methyl}furan-2-carboxylate
Chemical Structure Depiction of
methyl 5-methyl-4-{[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]methyl}furan-2-carboxylate
methyl 5-methyl-4-{[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]methyl}furan-2-carboxylate
Compound characteristics
| Compound ID: | 4986-1192 |
| Compound Name: | methyl 5-methyl-4-{[(4-methyl-6-oxo-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-3-yl)oxy]methyl}furan-2-carboxylate |
| Molecular Weight: | 382.41 |
| Molecular Formula: | C22 H22 O6 |
| Smiles: | Cc1c(ccc2C3CCCCC=3C(=O)Oc12)OCc1cc(C(=O)OC)oc1C |
| Stereo: | ACHIRAL |
| logP: | 4.4894 |
| logD: | 4.4894 |
| logSw: | -4.5336 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 57.578 |
| InChI Key: | BJCFJBAUIOHKOR-UHFFFAOYSA-N |