3-[(2-methoxyphenyl)methylidene]-5-(naphthalen-2-yl)furan-2(3H)-one
Chemical Structure Depiction of
3-[(2-methoxyphenyl)methylidene]-5-(naphthalen-2-yl)furan-2(3H)-one
3-[(2-methoxyphenyl)methylidene]-5-(naphthalen-2-yl)furan-2(3H)-one
Compound characteristics
| Compound ID: | 4989-0096 |
| Compound Name: | 3-[(2-methoxyphenyl)methylidene]-5-(naphthalen-2-yl)furan-2(3H)-one |
| Molecular Weight: | 328.37 |
| Molecular Formula: | C22 H16 O3 |
| Smiles: | COc1ccccc1/C=C1/C=C(c2ccc3ccccc3c2)OC1=O |
| Stereo: | ACHIRAL |
| logP: | 5.5185 |
| logD: | 5.5185 |
| logSw: | -6.6011 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0987 |
| InChI Key: | STIMLJGYXZXCKM-UHFFFAOYSA-N |