2-({3-methoxy-2-[(propan-2-yl)oxy]phenyl}methylidene)-1H-indene-1,3(2H)-dione
Chemical Structure Depiction of
2-({3-methoxy-2-[(propan-2-yl)oxy]phenyl}methylidene)-1H-indene-1,3(2H)-dione
2-({3-methoxy-2-[(propan-2-yl)oxy]phenyl}methylidene)-1H-indene-1,3(2H)-dione
Compound characteristics
| Compound ID: | 4999-1683 |
| Compound Name: | 2-({3-methoxy-2-[(propan-2-yl)oxy]phenyl}methylidene)-1H-indene-1,3(2H)-dione |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C20 H18 O4 |
| Smiles: | CC(C)Oc1c(C=C2C(c3ccccc3C2=O)=O)cccc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.904 |
| logD: | 3.904 |
| logSw: | -4.2524 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.153 |
| InChI Key: | UBIFTQWUFINAPC-UHFFFAOYSA-N |