2-[2-(butan-2-yl)phenoxy]-N-{3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}acetamide
Chemical Structure Depiction of
2-[2-(butan-2-yl)phenoxy]-N-{3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}acetamide
2-[2-(butan-2-yl)phenoxy]-N-{3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}acetamide
Compound characteristics
| Compound ID: | 5042-0770 |
| Compound Name: | 2-[2-(butan-2-yl)phenoxy]-N-{3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}acetamide |
| Molecular Weight: | 417.46 |
| Molecular Formula: | C24 H23 N3 O4 |
| Smiles: | CCC(C)c1ccccc1OCC(Nc1cccc(c1)c1nnc(c2ccco2)o1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2745 |
| logD: | 5.2745 |
| logSw: | -5.1151 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.524 |
| InChI Key: | DRVQYMCSYOJXET-INIZCTEOSA-N |