6-(4-methoxyphenyl)-1,3-dimethyl-4-oxo-4H-cyclohepta[c]furan-8-yl benzoate
Chemical Structure Depiction of
6-(4-methoxyphenyl)-1,3-dimethyl-4-oxo-4H-cyclohepta[c]furan-8-yl benzoate
6-(4-methoxyphenyl)-1,3-dimethyl-4-oxo-4H-cyclohepta[c]furan-8-yl benzoate
Compound characteristics
| Compound ID: | 5051-0235 |
| Compound Name: | 6-(4-methoxyphenyl)-1,3-dimethyl-4-oxo-4H-cyclohepta[c]furan-8-yl benzoate |
| Molecular Weight: | 400.43 |
| Molecular Formula: | C25 H20 O5 |
| Smiles: | Cc1c2C(=CC(=CC(c2c(C)o1)=O)c1ccc(cc1)OC)OC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7358 |
| logD: | 4.7358 |
| logSw: | -4.8014 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.058 |
| InChI Key: | WLPYBHUMKWQWJL-UHFFFAOYSA-N |