methyl 2-amino-7,7-dimethyl-2',5-dioxo-1'-(prop-2-en-1-yl)-1',2',5,6,7,8-hexahydrospiro[[1]benzopyran-4,3'-indole]-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-7,7-dimethyl-2',5-dioxo-1'-(prop-2-en-1-yl)-1',2',5,6,7,8-hexahydrospiro[[1]benzopyran-4,3'-indole]-3-carboxylate
methyl 2-amino-7,7-dimethyl-2',5-dioxo-1'-(prop-2-en-1-yl)-1',2',5,6,7,8-hexahydrospiro[[1]benzopyran-4,3'-indole]-3-carboxylate
Compound characteristics
| Compound ID: | 5066-0183 |
| Compound Name: | methyl 2-amino-7,7-dimethyl-2',5-dioxo-1'-(prop-2-en-1-yl)-1',2',5,6,7,8-hexahydrospiro[[1]benzopyran-4,3'-indole]-3-carboxylate |
| Molecular Weight: | 408.45 |
| Molecular Formula: | C23 H24 N2 O5 |
| Smiles: | CC1(C)CC2=C(C(C1)=O)C1(C(=C(N)O2)C(=O)OC)C(N(CC=C)c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4669 |
| logD: | 2.4669 |
| logSw: | -2.8357 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.438 |
| InChI Key: | LDDKBWHDLQAQPC-HSZRJFAPSA-N |