N-{4-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)sulfamoyl]phenyl}acetamide
Chemical Structure Depiction of
N-{4-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)sulfamoyl]phenyl}acetamide
N-{4-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)sulfamoyl]phenyl}acetamide
Compound characteristics
| Compound ID: | 5067-1478 |
| Compound Name: | N-{4-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)sulfamoyl]phenyl}acetamide |
| Molecular Weight: | 332.39 |
| Molecular Formula: | C12 H16 N2 O5 S2 |
| Smiles: | CC(Nc1ccc(cc1)S(NC1CCS(C1)(=O)=O)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.1938 |
| logD: | -0.1941 |
| logSw: | -1.8799 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.634 |
| InChI Key: | VDLLJVXKUITENX-LLVKDONJSA-N |