(4-methoxyphenyl)(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone
Chemical Structure Depiction of
(4-methoxyphenyl)(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone
(4-methoxyphenyl)(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone
Compound characteristics
| Compound ID: | 5069-0244 |
| Compound Name: | (4-methoxyphenyl)(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
| Molecular Weight: | 253.34 |
| Molecular Formula: | C11 H11 N O2 S2 |
| Smiles: | COc1ccc(cc1)C(N1CCSC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9599 |
| logD: | 1.9599 |
| logSw: | -2.3017 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 24.4678 |
| InChI Key: | PRVIBPPECORITJ-UHFFFAOYSA-N |