dimethyl 1-(adamantan-1-yl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
dimethyl 1-(adamantan-1-yl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 1-(adamantan-1-yl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | 5071-7811 |
| Compound Name: | dimethyl 1-(adamantan-1-yl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 441.95 |
| Molecular Formula: | C25 H28 Cl N O4 |
| Smiles: | COC(C1=CN(C=C(C1c1ccccc1[Cl])C(=O)OC)C12CC3CC(CC(C3)C2)C1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4191 |
| logD: | 5.4191 |
| logSw: | -5.9171 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.688 |
| InChI Key: | QIPCIQRAKYCVMW-UHFFFAOYSA-N |